C21H31F3N4 — CID 174097123
(2E,7E)-9-(1,4-diazepan-1-yl)-5-ethenyl-3,8-dimethyl-6-(2,2,2-trifluoroethylimino)deca-2,4,7,9-tetraen-4-amine (PubChem CID 174097123) has the molecular formula C21H31F3N4 and a molecular weight of 396.50 g/mol. Its IUPAC name is (2E,7E)-9-(1,4-diazepan-1-yl)-5-ethenyl-3,8-dimethyl-6-(2,2,2-trifluoroethylimino)deca-2,4,7,9-tetraen-4-amine.
| Compound Name | (2E,7E)-9-(1,4-diazepan-1-yl)-5-ethenyl-3,8-dimethyl-6-(2,2,2-trifluoroethylimino)deca-2,4,7,9-tetraen-4-amine |
|---|---|
| PubChem CID | 174097123 |
| Molecular Formula | C21H31F3N4 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (2E,7E)-9-(1,4-diazepan-1-yl)-5-ethenyl-3,8-dimethyl-6-(2,2,2-trifluoroethylimino)deca-2,4,7,9-tetraen-4-amine |
| SMILES | C=CC(=C(N)/C(C)=C/C)C(/C=C(\C)C(=C)N1CCCNCC1)=N/CC(F)(F)F |
| InChI | InChI=1S/C21H31F3N4/c1-6-15(3)20(25)18(7-2)19(27-14-21(22,23)24)13-16(4)17(5)28-11-8-9-26-10-12-28/h6-7,13,26H,2,5,8-12,14,25H2,1,3-4H3/b15-6+,16-13+,20-18?,27-19+ |
| InChIKey | AVCWMIRIAMENHF-MOGQZWMCSA-N |
| XLogP | 4.11 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|