C10H11F2N5S2 — CID 17409713
5-[[1-(difluoromethyl)imidazol-2-yl]methylsulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine (PubChem CID 17409713) has the molecular formula C10H11F2N5S2 and a molecular weight of 303.36 g/mol. Its IUPAC name is 5-[[1-(difluoromethyl)imidazol-2-yl]methylsulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[[1-(difluoromethyl)imidazol-2-yl]methylsulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 17409713 |
| Molecular Formula | C10H11F2N5S2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 5-[[1-(difluoromethyl)imidazol-2-yl]methylsulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
| SMILES | C=CCNc1nnc(SCc2nccn2C(F)F)s1 |
| InChI | InChI=1S/C10H11F2N5S2/c1-2-3-14-9-15-16-10(19-9)18-6-7-13-4-5-17(7)8(11)12/h2,4-5,8H,1,3,6H2,(H,14,15) |
| InChIKey | BSGRVHHTEHPEDY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|