C23H33F4N3 — CID 174097133
(4Z,6E)-1-[(4Z,6E)-7-fluoro-5-methylnona-4,6-dienyl]imino-2,8-dimethyl-5-N-(2,2,2-trifluoroethyl)nona-2,4,6,8-tetraene-3,5-diamine (PubChem CID 174097133) has the molecular formula C23H33F4N3 and a molecular weight of 427.53 g/mol. Its IUPAC name is (4Z,6E)-1-[(4Z,6E)-7-fluoro-5-methylnona-4,6-dienyl]imino-2,8-dimethyl-5-N-(2,2,2-trifluoroethyl)nona-2,4,6,8-tetraene-3,5-diamine.
| Compound Name | (4Z,6E)-1-[(4Z,6E)-7-fluoro-5-methylnona-4,6-dienyl]imino-2,8-dimethyl-5-N-(2,2,2-trifluoroethyl)nona-2,4,6,8-tetraene-3,5-diamine |
|---|---|
| PubChem CID | 174097133 |
| Molecular Formula | C23H33F4N3 |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (4Z,6E)-1-[(4Z,6E)-7-fluoro-5-methylnona-4,6-dienyl]imino-2,8-dimethyl-5-N-(2,2,2-trifluoroethyl)nona-2,4,6,8-tetraene-3,5-diamine |
| SMILES | C=C(C)/C=C/C(=C/C(N)=C(C)/C=N/CCC/C=C(C)\C=C(\F)CC)NCC(F)(F)F |
| InChI | InChI=1S/C23H33F4N3/c1-6-20(24)13-18(4)9-7-8-12-29-15-19(5)22(28)14-21(11-10-17(2)3)30-16-23(25,26)27/h9-11,13-15,30H,2,6-8,12,16,28H2,1,3-5H3/b11-10+,18-9-,20-13+,21-14-,22-19?,29-15+ |
| InChIKey | PTAVMPVDSIAOBO-JFMMUMHHSA-N |
| XLogP | 6.45 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|