C12H16FN — CID 174097154
(Z)-N-[(1E,3E)-1-fluoro-4-methylhexa-1,3,5-trienyl]pent-3-en-2-imine (PubChem CID 174097154) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is (Z)-N-[(1E,3E)-1-fluoro-4-methylhexa-1,3,5-trienyl]pent-3-en-2-imine.
| Compound Name | (Z)-N-[(1E,3E)-1-fluoro-4-methylhexa-1,3,5-trienyl]pent-3-en-2-imine |
|---|---|
| PubChem CID | 174097154 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (Z)-N-[(1E,3E)-1-fluoro-4-methylhexa-1,3,5-trienyl]pent-3-en-2-imine |
| SMILES | C=C/C(C)=C/C=C(/F)N=C(C)/C=C\C |
| InChI | InChI=1S/C12H16FN/c1-5-7-11(4)14-12(13)9-8-10(3)6-2/h5-9H,2H2,1,3-4H3/b7-5-,10-8+,12-9-,14-11? |
| InChIKey | FTVXMEOVSZZTCL-NRSJLQIBSA-N |
| XLogP | 3.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|