C26H29FN2 — CID 174097753
(16E)-18-fluoro-10,19-dimethyl-5,20-dimethylidene-4,15-diazapentacyclo[14.7.1.02,14.04,13.06,11]tetracosa-1,6(11),12,14,16,18-hexaene (PubChem CID 174097753) has the molecular formula C26H29FN2 and a molecular weight of 388.53 g/mol. Its IUPAC name is (16E)-18-fluoro-10,19-dimethyl-5,20-dimethylidene-4,15-diazapentacyclo[14.7.1.02,14.04,13.06,11]tetracosa-1,6(11),12,14,16,18-hexaene.
| Compound Name | (16E)-18-fluoro-10,19-dimethyl-5,20-dimethylidene-4,15-diazapentacyclo[14.7.1.02,14.04,13.06,11]tetracosa-1,6(11),12,14,16,18-hexaene |
|---|---|
| PubChem CID | 174097753 |
| Molecular Formula | C26H29FN2 |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | (16E)-18-fluoro-10,19-dimethyl-5,20-dimethylidene-4,15-diazapentacyclo[14.7.1.02,14.04,13.06,11]tetracosa-1,6(11),12,14,16,18-hexaene |
| SMILES | C=C1CCCC2=C3CN4C(=C)C5=C(C=C4C3=N/C(=C/C(F)=C1C)C2)C(C)CCC5 |
| InChI | InChI=1S/C26H29FN2/c1-15-7-5-9-19-11-20(12-24(27)17(15)3)28-26-23(19)14-29-18(4)21-10-6-8-16(2)22(21)13-25(26)29/h12-13,16H,1,4-11,14H2,2-3H3/b20-12+,24-17? |
| InChIKey | OWPYAQGIHFUZDP-BJCXTYANSA-N |
| XLogP | 6.84 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |