C48H47N5O — CID 174097999
3-[4-(1-adamantyl)-6-[(3R)-1,3,6-trimethylcycloheptyl]-1,3,5-triazin-2-yl]-4-([1]benzofuro[3,2-a]carbazol-12-yl)benzonitrile (PubChem CID 174097999) has the molecular formula C48H47N5O and a molecular weight of 709.94 g/mol. Its IUPAC name is 3-[4-(1-adamantyl)-6-[(3R)-1,3,6-trimethylcycloheptyl]-1,3,5-triazin-2-yl]-4-([1]benzofuro[3,2-a]carbazol-12-yl)benzonitrile.
| Compound Name | 3-[4-(1-adamantyl)-6-[(3R)-1,3,6-trimethylcycloheptyl]-1,3,5-triazin-2-yl]-4-([1]benzofuro[3,2-a]carbazol-12-yl)benzonitrile |
|---|---|
| PubChem CID | 174097999 |
| Molecular Formula | C48H47N5O |
| Molecular Weight | 709.94 g/mol |
| Exact Mass | 709.38 |
| IUPAC Name | 3-[4-(1-adamantyl)-6-[(3R)-1,3,6-trimethylcycloheptyl]-1,3,5-triazin-2-yl]-4-([1]benzofuro[3,2-a]carbazol-12-yl)benzonitrile |
| SMILES | CC1CC[C@@H](C)CC(C)(c2nc(-c3cc(C#N)ccc3-n3c4ccccc4c4ccc5oc6ccccc6c5c43)nc(C34CC5CC(CC(C5)C3)C4)n2)C1 |
| InChI | InChI=1S/C48H47N5O/c1-28-12-13-29(2)23-47(3,22-28)45-50-44(51-46(52-45)48-24-31-18-32(25-48)20-33(19-31)26-48)37-21-30(27-49)14-16-39(37)53-38-10-6-4-8-34(38)35-15-17-41-42(43(35)53)36-9-5-7-11-40(36)54-41/h4-11,14-17,21,28-29,31-33H,12-13,18-20,22-26H2,1-3H3/t28-,29?,31?,32?,33?,47?,48?/m1/s1 |
| InChIKey | CYRKDZMVYOBHFR-QQNQUEJRSA-N |
| XLogP | 11.98 |
| TPSA | 80.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.94 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |