C24H33NOSi — CID 174098052
(1S)-1-[(2S,3aS,7aS)-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]-2-[methyl(diphenyl)silyl]ethanol (PubChem CID 174098052) has the molecular formula C24H33NOSi and a molecular weight of 379.62 g/mol. Its IUPAC name is (1S)-1-[(2S,3aS,7aS)-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]-2-[methyl(diphenyl)silyl]ethanol.
| Compound Name | (1S)-1-[(2S,3aS,7aS)-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]-2-[methyl(diphenyl)silyl]ethanol |
|---|---|
| PubChem CID | 174098052 |
| Molecular Formula | C24H33NOSi |
| Molecular Weight | 379.62 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | (1S)-1-[(2S,3aS,7aS)-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]-2-[methyl(diphenyl)silyl]ethanol |
| SMILES | CN1[C@H]2CCCC[C@H]2C[C@H]1[C@H](O)C[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33NOSi/c1-25-22-16-10-9-11-19(22)17-23(25)24(26)18-27(2,20-12-5-3-6-13-20)21-14-7-4-8-15-21/h3-8,12-15,19,22-24,26H,9-11,16-18H2,1-2H3/t19-,22-,23-,24+/m0/s1 |
| InChIKey | DLGRYKKKBTZQSX-ZNEWLNCYSA-N |
| XLogP | 3.50 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.62 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|