About (2S)-N,2-dimethyl-3-methylsulfanyl-N-prop-1-en-2-ylpropan-1-amine
(2S)-N,2-dimethyl-3-methylsulfanyl-N-prop-1-en-2-ylpropan-1-amine (PubChem CID 174098200) has the molecular formula C9H19NS
and a molecular weight of 173.32 g/mol. Its IUPAC name is (2S)-N,2-dimethyl-3-methylsulfanyl-N-prop-1-en-2-ylpropan-1-amine.
Molecular Properties
| Compound Name | (2S)-N,2-dimethyl-3-methylsulfanyl-N-prop-1-en-2-ylpropan-1-amine |
| PubChem CID | 174098200 |
| Molecular Formula | C9H19NS |
| Molecular Weight | 173.32 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (2S)-N,2-dimethyl-3-methylsulfanyl-N-prop-1-en-2-ylpropan-1-amine |
| SMILES | C=C(C)N(C)C[C@H](C)CSC |
| InChI | InChI=1S/C9H19NS/c1-8(2)10(4)6-9(3)7-11-5/h9H,1,6-7H2,2-5H3/t9-/m0/s1 |
| InChIKey | XSYHJMSLWWMWQY-VIFPVBQESA-N |
| XLogP | 2.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-N,2-dimethyl-3-methylsulfanyl-N-prop-1-en-2-ylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,2-dimethyl-3-methylsulfanyl-N-prop-1-en-2-ylpropan-1-amine?
The IUPAC name of (2S)-N,2-dimethyl-3-methylsulfanyl-N-prop-1-en-2-ylpropan-1-amine (CID 174098200) is (2S)-N,2-dimethyl-3-methylsulfanyl-N-prop-1-en-2-ylpropan-1-amine.
What is the SMILES notation for (2S)-N,2-dimethyl-3-methylsulfanyl-N-prop-1-en-2-ylpropan-1-amine?
The canonical SMILES for (2S)-N,2-dimethyl-3-methylsulfanyl-N-prop-1-en-2-ylpropan-1-amine is C=C(C)N(C)C[C@H](C)CSC.
What is the InChIKey of (2S)-N,2-dimethyl-3-methylsulfanyl-N-prop-1-en-2-ylpropan-1-amine?
The InChIKey is XSYHJMSLWWMWQY-VIFPVBQESA-N. The full InChI is InChI=1S/C9H19NS/c1-8(2)10(4)6-9(3)7-11-5/h9H,1,6-7H2,2-5H3/t9-/m0/s1.
What are the key properties of (2S)-N,2-dimethyl-3-methylsulfanyl-N-prop-1-en-2-ylpropan-1-amine?
(2S)-N,2-dimethyl-3-methylsulfanyl-N-prop-1-en-2-ylpropan-1-amine has a molecular weight of 173.32 g/mol, XLogP of 2.45, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,2-dimethyl-3-methylsulfanyl-N-prop-1-en-2-ylpropan-1-amine is sourced from PubChem (CID 174098200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).