C36H38N3Si+ — CID 174099217
trimethyl-[(Z)-3-(3-methylidene-7-phenyl-14,26-diaza-4-azoniapentacyclo[16.8.0.04,9.010,15.019,24]hexacosa-4(9),5,7,10(15),11,13,19,21,23,25-decaen-25-yl)prop-2-enyl]silane (PubChem CID 174099217) has the molecular formula C36H38N3Si+ and a molecular weight of 540.81 g/mol. Its IUPAC name is trimethyl-[(Z)-3-(3-methylidene-7-phenyl-14,26-diaza-4-azoniapentacyclo[16.8.0.04,9.010,15.019,24]hexacosa-4(9),5,7,10(15),11,13,19,21,23,25-decaen-25-yl)prop-2-enyl]silane.
| Compound Name | trimethyl-[(Z)-3-(3-methylidene-7-phenyl-14,26-diaza-4-azoniapentacyclo[16.8.0.04,9.010,15.019,24]hexacosa-4(9),5,7,10(15),11,13,19,21,23,25-decaen-25-yl)prop-2-enyl]silane |
|---|---|
| PubChem CID | 174099217 |
| Molecular Formula | C36H38N3Si+ |
| Molecular Weight | 540.81 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | trimethyl-[(Z)-3-(3-methylidene-7-phenyl-14,26-diaza-4-azoniapentacyclo[16.8.0.04,9.010,15.019,24]hexacosa-4(9),5,7,10(15),11,13,19,21,23,25-decaen-25-yl)prop-2-enyl]silane |
| SMILES | C=C1CC2N=C(/C=C\C[Si](C)(C)C)c3ccccc3C2CCc2ncccc2-c2cc(-c3ccccc3)cc[n+]21 |
| InChI | InChI=1S/C36H38N3Si/c1-26-24-35-31(29-14-8-9-15-30(29)34(38-35)17-11-23-40(2,3)4)18-19-33-32(16-10-21-37-33)36-25-28(20-22-39(26)36)27-12-6-5-7-13-27/h5-17,20-22,25,31,35H,1,18-19,23-24H2,2-4H3/q+1/b17-11- |
| InChIKey | UZNHZLVVEMUVDW-BOPFTXTBSA-N |
| XLogP | 8.36 |
| TPSA | 29.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.81 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|