C27H28F2N8O3 — CID 174099456
N'-[6-[4-[[5-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]oxy-6-methoxyquinazolin-4-yl]amino]-2-methylphenoxy]pyrimidin-4-yl]methanimidamide (PubChem CID 174099456) has the molecular formula C27H28F2N8O3 and a molecular weight of 550.57 g/mol. Its IUPAC name is N'-[6-[4-[[5-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]oxy-6-methoxyquinazolin-4-yl]amino]-2-methylphenoxy]pyrimidin-4-yl]methanimidamide.
| Compound Name | N'-[6-[4-[[5-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]oxy-6-methoxyquinazolin-4-yl]amino]-2-methylphenoxy]pyrimidin-4-yl]methanimidamide |
|---|---|
| PubChem CID | 174099456 |
| Molecular Formula | C27H28F2N8O3 |
| Molecular Weight | 550.57 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | N'-[6-[4-[[5-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]oxy-6-methoxyquinazolin-4-yl]amino]-2-methylphenoxy]pyrimidin-4-yl]methanimidamide |
| SMILES | COc1ccc2ncnc(Nc3ccc(Oc4cc(N=CN)ncn4)c(C)c3)c2c1O[C@@H]1CCN(C)CC1(F)F |
| InChI | InChI=1S/C27H28F2N8O3/c1-16-10-17(4-6-19(16)39-23-11-22(31-13-30)33-15-34-23)36-26-24-18(32-14-35-26)5-7-20(38-3)25(24)40-21-8-9-37(2)12-27(21,28)29/h4-7,10-11,13-15,21H,8-9,12H2,1-3H3,(H,32,35,36)(H2,30,31,33,34)/t21-/m1/s1 |
| InChIKey | PJTZGGXKRCRCMI-OAQYLSRUSA-N |
| XLogP | 4.61 |
| TPSA | 132.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|