C19H22BCl2N4O3+ — CID 174099526
N-[6-chloro-1-[[2-(5-chloro-3-pyridinyl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]methyl]pyrimidin-1-ium-4-yl]cyclopropanecarboxamide (PubChem CID 174099526) has the molecular formula C19H22BCl2N4O3+ and a molecular weight of 436.13 g/mol. Its IUPAC name is N-[6-chloro-1-[[2-(5-chloro-3-pyridinyl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]methyl]pyrimidin-1-ium-4-yl]cyclopropanecarboxamide.
| Compound Name | N-[6-chloro-1-[[2-(5-chloro-3-pyridinyl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]methyl]pyrimidin-1-ium-4-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 174099526 |
| Molecular Formula | C19H22BCl2N4O3+ |
| Molecular Weight | 436.13 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-[6-chloro-1-[[2-(5-chloro-3-pyridinyl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]methyl]pyrimidin-1-ium-4-yl]cyclopropanecarboxamide |
| SMILES | CC1(C)OB(c2cncc(Cl)c2)OC1(C)C[n+]1cnc(NC(=O)C2CC2)cc1Cl |
| InChI | InChI=1S/C19H21BCl2N4O3/c1-18(2)19(3,29-20(28-18)13-6-14(21)9-23-8-13)10-26-11-24-16(7-15(26)22)25-17(27)12-4-5-12/h6-9,11-12H,4-5,10H2,1-3H3/p+1 |
| InChIKey | KSZXKRYLBNYNSV-UHFFFAOYSA-O |
| XLogP | 2.40 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.13 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|