C54H33B5N2 — CID 174099542
CID 174099542 (PubChem CID 174099542) has the molecular formula C54H33B5N2 and a molecular weight of 763.93 g/mol.
| Compound Name | CID 174099542 |
|---|---|
| PubChem CID | 174099542 |
| Molecular Formula | C54H33B5N2 |
| Molecular Weight | 763.93 g/mol |
| Exact Mass | 764.31 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-n2c3ccccc3c3c(-c4cccc(N(c5ccc(-c6ccccc6)cc5)c5ccc(-c6ccc(-c7ccccc7)cc6)cc5)c4)cccc32)c([B])c1[B] |
| InChI | InChI=1S/C54H33B5N2/c55-49-50(56)52(58)54(53(59)51(49)57)61-46-19-8-7-17-45(46)48-44(18-10-20-47(48)61)40-15-9-16-43(33-40)60(41-29-25-38(26-30-41)35-13-5-2-6-14-35)42-31-27-39(28-32-42)37-23-21-36(22-24-37)34-11-3-1-4-12-34/h1-33H |
| InChIKey | PEXQWXAMLJFABK-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.93 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|