C19H20Cl2F3N3O — CID 174099629
3-amino-2-[cyclopropyl-[3-(3,4-dichlorophenyl)but-3-en-2-yl]carbamoyl]-4,4-difluoro-N-methylbut-2-enimidoyl fluoride (PubChem CID 174099629) has the molecular formula C19H20Cl2F3N3O and a molecular weight of 434.29 g/mol. Its IUPAC name is 3-amino-2-[cyclopropyl-[3-(3,4-dichlorophenyl)but-3-en-2-yl]carbamoyl]-4,4-difluoro-N-methylbut-2-enimidoyl fluoride.
| Compound Name | 3-amino-2-[cyclopropyl-[3-(3,4-dichlorophenyl)but-3-en-2-yl]carbamoyl]-4,4-difluoro-N-methylbut-2-enimidoyl fluoride |
|---|---|
| PubChem CID | 174099629 |
| Molecular Formula | C19H20Cl2F3N3O |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 3-amino-2-[cyclopropyl-[3-(3,4-dichlorophenyl)but-3-en-2-yl]carbamoyl]-4,4-difluoro-N-methylbut-2-enimidoyl fluoride |
| SMILES | C=C(c1ccc(Cl)c(Cl)c1)C(C)N(C(=O)C(=C(N)C(F)F)/C(F)=N/C)C1CC1 |
| InChI | InChI=1S/C19H20Cl2F3N3O/c1-9(11-4-7-13(20)14(21)8-11)10(2)27(12-5-6-12)19(28)15(18(24)26-3)16(25)17(22)23/h4,7-8,10,12,17H,1,5-6,25H2,2-3H3/b16-15?,26-18- |
| InChIKey | SCTPYXOSOJSUMH-PBNNHKJMSA-N |
| XLogP | 4.86 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|