C50H47BBr2FN2+ — CID 174099722
4,12-bis(4-bromophenyl)-6,10-bis(4-tert-butylphenyl)-2-fluoro-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 174099722) has the molecular formula C50H47BBr2FN2+ and a molecular weight of 865.56 g/mol. Its IUPAC name is 4,12-bis(4-bromophenyl)-6,10-bis(4-tert-butylphenyl)-2-fluoro-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 4,12-bis(4-bromophenyl)-6,10-bis(4-tert-butylphenyl)-2-fluoro-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 174099722 |
| Molecular Formula | C50H47BBr2FN2+ |
| Molecular Weight | 865.56 g/mol |
| Exact Mass | 863.22 |
| IUPAC Name | 4,12-bis(4-bromophenyl)-6,10-bis(4-tert-butylphenyl)-2-fluoro-8-(2,4,6-trimethylphenyl)-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | Cc1cc(C)c(C2=C3C(c4ccc(C(C)(C)C)cc4)=CC(c4ccc(Br)cc4)=[N+]3B(F)n3c(-c4ccc(Br)cc4)cc(-c4ccc(C(C)(C)C)cc4)c32)c(C)c1 |
| InChI | InChI=1S/C50H47BBr2FN2/c1-30-26-31(2)45(32(3)27-30)46-47-41(33-10-18-37(19-11-33)49(4,5)6)28-43(35-14-22-39(52)23-15-35)55(47)51(54)56-44(36-16-24-40(53)25-17-36)29-42(48(46)56)34-12-20-38(21-13-34)50(7,8)9/h10-29H,1-9H3/q+1 |
| InChIKey | OSPIVNWUYORSLQ-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.56 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|