C43H34B5N — CID 174099797
CID 174099797 (PubChem CID 174099797) has the molecular formula C43H34B5N and a molecular weight of 618.81 g/mol.
| Compound Name | CID 174099797 |
|---|---|
| PubChem CID | 174099797 |
| Molecular Formula | C43H34B5N |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 619.32 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(N(c2ccc3c(c2)C2(c4ccccc4-3)C3CC4CC(C3)CC2C4)c2cccc3c2-c2ccccc2C3(C)C)c([B])c1[B] |
| InChI | InChI=1S/C43H34B5N/c1-42(2)30-10-5-4-9-29(30)35-32(42)12-7-13-34(35)49(41-39(47)37(45)36(44)38(46)40(41)48)26-14-15-28-27-8-3-6-11-31(27)43(33(28)21-26)24-17-22-16-23(19-24)20-25(43)18-22/h3-15,21-25H,16-20H2,1-2H3 |
| InChIKey | HIGXEFNZPMDGRE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|