About CID 174100077
CID 174100077 (PubChem CID 174100077) has the molecular formula C47H25B5N4O25
and a molecular weight of 1099.78 g/mol.
Molecular Properties
| Compound Name | CID 174100077 |
| PubChem CID | 174100077 |
| Molecular Formula | C47H25B5N4O25 |
| Molecular Weight | 1099.78 g/mol |
| Exact Mass | 1100.13 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c(O)c2c(c1O)c1c(O)c(O)c([B])c(O)c1n2-c1nc(-n2c3c(O)c([B])c(O)c(O)c3c3c(O)c(O)c(O)c(O)c32)c(O)c(-c2c(O)c(O)c(O)c(O)c2-n2c3c(O)c(O)c([B])c(O)c3c3c(O)c(O)c(O)c(O)c32)c1O |
| InChI | InChI=1S/C47H25B5N4O25/c48-9-10(49)30(66)14-1(21(9)57)3-15(31(67)12(51)33(69)23(3)59)55(14)46-28(64)8(29(65)47(53-46)56-16-5(24(60)34(70)13(52)32(16)68)6-20(56)39(75)45(81)41(77)26(6)62)7-19(38(74)44(80)42(78)27(7)63)54-17-2(22(58)11(50)35(71)36(17)72)4-18(54)37(73)43(79)40(76)25(4)61/h57-81H |
| InChIKey | ORPACVSNMGGTHY-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 533.43 Ų |
| H-Bond Donors | 25 |
| H-Bond Acceptors | 29 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 81 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1099.78 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 25 |
| H-Bond Acceptors ≤ 10 | 29 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze CID 174100077 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174100077?
The IUPAC name of CID 174100077 (CID 174100077) is not available.
What is the SMILES notation for CID 174100077?
The canonical SMILES for CID 174100077 is [B]c1c([B])c(O)c2c(c1O)c1c(O)c(O)c([B])c(O)c1n2-c1nc(-n2c3c(O)c([B])c(O)c(O)c3c3c(O)c(O)c(O)c(O)c32)c(O)c(-c2c(O)c(O)c(O)c(O)c2-n2c3c(O)c(O)c([B])c(O)c3c3c(O)c(O)c(O)c(O)c32)c1O.
What is the InChIKey of CID 174100077?
The InChIKey is ORPACVSNMGGTHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C47H25B5N4O25/c48-9-10(49)30(66)14-1(21(9)57)3-15(31(67)12(51)33(69)23(3)59)55(14)46-28(64)8(29(65)47(53-46)56-16-5(24(60)34(70)13(52)32(16)68)6-20(56)39(75)45(81)41(77)26(6)62)7-19(38(74)44(80)42(78)27(7)63)54-17-2(22(58)11(50)35(71)36(17)72)4-18(54)37(73)43(79)40(76)25(4)61/h57-81H.
What are the key properties of CID 174100077?
CID 174100077 has a molecular weight of 1099.78 g/mol, XLogP of -1.35, 4 rotatable bonds, 25 hydrogen bond donors, and 29 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174100077 is sourced from PubChem (CID 174100077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).