C25H38O7S — CID 174100153
(4R)-1-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methoxyoxolan-2-yl]-4-methylhexan-2-one (PubChem CID 174100153) has the molecular formula C25H38O7S and a molecular weight of 482.64 g/mol. Its IUPAC name is (4R)-1-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methoxyoxolan-2-yl]-4-methylhexan-2-one.
| Compound Name | (4R)-1-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methoxyoxolan-2-yl]-4-methylhexan-2-one |
|---|---|
| PubChem CID | 174100153 |
| Molecular Formula | C25H38O7S |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | (4R)-1-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methoxyoxolan-2-yl]-4-methylhexan-2-one |
| SMILES | CC[C@@H](C)CC(=O)C[C@@H]1O[C@H](C[C@H]2COC(C)(C)O2)[C@H](OC)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H38O7S/c1-6-17(2)12-18(26)13-22-21(16-33(27,28)20-10-8-7-9-11-20)24(29-5)23(31-22)14-19-15-30-25(3,4)32-19/h7-11,17,19,21-24H,6,12-16H2,1-5H3/t17-,19+,21+,22+,23-,24-/m1/s1 |
| InChIKey | XLUZKBOLQQRDFT-QHYGOWJGSA-N |
| XLogP | 3.80 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |