C17H33NO3Si — CID 174100550
methyl (2R,3S,3aR,6aR)-3-methyl-2-(triethylsilyloxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate (PubChem CID 174100550) has the molecular formula C17H33NO3Si and a molecular weight of 327.54 g/mol. Its IUPAC name is methyl (2R,3S,3aR,6aR)-3-methyl-2-(triethylsilyloxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate.
| Compound Name | methyl (2R,3S,3aR,6aR)-3-methyl-2-(triethylsilyloxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 174100550 |
| Molecular Formula | C17H33NO3Si |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | methyl (2R,3S,3aR,6aR)-3-methyl-2-(triethylsilyloxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxylate |
| SMILES | CC[Si](CC)(CC)OC[C@H]1[C@@H](C)[C@H]2CCC[C@H]2N1C(=O)OC |
| InChI | InChI=1S/C17H33NO3Si/c1-6-22(7-2,8-3)21-12-16-13(4)14-10-9-11-15(14)18(16)17(19)20-5/h13-16H,6-12H2,1-5H3/t13-,14+,15+,16-/m0/s1 |
| InChIKey | BRKQLYYHIVNURT-JJXSEGSLSA-N |
| XLogP | 4.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|