C33H28BFN4O2 — CID 174100672
9-[4-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]carbazole (PubChem CID 174100672) has the molecular formula C33H28BFN4O2 and a molecular weight of 542.42 g/mol. Its IUPAC name is 9-[4-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]carbazole.
| Compound Name | 9-[4-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]carbazole |
|---|---|
| PubChem CID | 174100672 |
| Molecular Formula | C33H28BFN4O2 |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 9-[4-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]carbazole |
| SMILES | CC1(C)OB(c2ccc(F)c(-c3nc(-c4ccccc4)nc(-n4c5ccccc5c5ccccc54)n3)c2)OC1(C)C |
| InChI | InChI=1S/C33H28BFN4O2/c1-32(2)33(3,4)41-34(40-32)22-18-19-26(35)25(20-22)30-36-29(21-12-6-5-7-13-21)37-31(38-30)39-27-16-10-8-14-23(27)24-15-9-11-17-28(24)39/h5-20H,1-4H3 |
| InChIKey | GJQCWMKIOZAEFQ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|