About 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-phenyl-1,3-thiazol-2-amine
4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-phenyl-1,3-thiazol-2-amine (PubChem CID 17410113) has the molecular formula C16H21N3OS
and a molecular weight of 303.43 g/mol. Its IUPAC name is 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-phenyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-phenyl-1,3-thiazol-2-amine |
| PubChem CID | 17410113 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-phenyl-1,3-thiazol-2-amine |
| SMILES | CC1CN(Cc2csc(Nc3ccccc3)n2)CC(C)O1 |
| InChI | InChI=1S/C16H21N3OS/c1-12-8-19(9-13(2)20-12)10-15-11-21-16(18-15)17-14-6-4-3-5-7-14/h3-7,11-13H,8-10H2,1-2H3,(H,17,18) |
| InChIKey | ALTOSZLWPBXEHC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-phenyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-phenyl-1,3-thiazol-2-amine?
The IUPAC name of 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-phenyl-1,3-thiazol-2-amine (CID 17410113) is 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-phenyl-1,3-thiazol-2-amine.
What is the SMILES notation for 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-phenyl-1,3-thiazol-2-amine?
The canonical SMILES for 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-phenyl-1,3-thiazol-2-amine is CC1CN(Cc2csc(Nc3ccccc3)n2)CC(C)O1.
What is the InChIKey of 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-phenyl-1,3-thiazol-2-amine?
The InChIKey is ALTOSZLWPBXEHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3OS/c1-12-8-19(9-13(2)20-12)10-15-11-21-16(18-15)17-14-6-4-3-5-7-14/h3-7,11-13H,8-10H2,1-2H3,(H,17,18).
What are the key properties of 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-phenyl-1,3-thiazol-2-amine?
4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-phenyl-1,3-thiazol-2-amine has a molecular weight of 303.43 g/mol, XLogP of 3.50, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dimethylmorpholin-4-yl)methyl]-N-phenyl-1,3-thiazol-2-amine is sourced from PubChem (CID 17410113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).