C16H29NO2 — CID 174101363
tert-butyl (2S,5Z)-5-ethylidene-2,3,4-trimethylazepane-1-carboxylate (PubChem CID 174101363) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is tert-butyl (2S,5Z)-5-ethylidene-2,3,4-trimethylazepane-1-carboxylate.
| Compound Name | tert-butyl (2S,5Z)-5-ethylidene-2,3,4-trimethylazepane-1-carboxylate |
|---|---|
| PubChem CID | 174101363 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | tert-butyl (2S,5Z)-5-ethylidene-2,3,4-trimethylazepane-1-carboxylate |
| SMILES | C/C=C1/CCN(C(=O)OC(C)(C)C)[C@@H](C)C(C)C1C |
| InChI | InChI=1S/C16H29NO2/c1-8-14-9-10-17(13(4)11(2)12(14)3)15(18)19-16(5,6)7/h8,11-13H,9-10H2,1-7H3/b14-8-/t11?,12?,13-/m0/s1 |
| InChIKey | BXYARUUFOXNTHX-RMFMIZQHSA-N |
| XLogP | 4.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|