C12H26OSi — CID 174101366
tert-butyl-(1,3-dimethylcyclobutyl)oxy-dimethylsilane (PubChem CID 174101366) has the molecular formula C12H26OSi and a molecular weight of 214.42 g/mol. Its IUPAC name is tert-butyl-(1,3-dimethylcyclobutyl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(1,3-dimethylcyclobutyl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 174101366 |
| Molecular Formula | C12H26OSi |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | tert-butyl-(1,3-dimethylcyclobutyl)oxy-dimethylsilane |
| SMILES | CC1CC(C)(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C12H26OSi/c1-10-8-12(5,9-10)13-14(6,7)11(2,3)4/h10H,8-9H2,1-7H3 |
| InChIKey | JRVJXJAHNIZJMO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|