C19H22FN3OS2 — CID 174101387
2-(4-fluoro-2-methoxyphenyl)-1-(methylamino)-1-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)pent-1-ene-3-thione (PubChem CID 174101387) has the molecular formula C19H22FN3OS2 and a molecular weight of 391.54 g/mol. Its IUPAC name is 2-(4-fluoro-2-methoxyphenyl)-1-(methylamino)-1-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)pent-1-ene-3-thione.
| Compound Name | 2-(4-fluoro-2-methoxyphenyl)-1-(methylamino)-1-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)pent-1-ene-3-thione |
|---|---|
| PubChem CID | 174101387 |
| Molecular Formula | C19H22FN3OS2 |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-(4-fluoro-2-methoxyphenyl)-1-(methylamino)-1-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)pent-1-ene-3-thione |
| SMILES | CCC(=S)C(=C(NC)c1nc2c(s1)CNCC2)c1ccc(F)cc1OC |
| InChI | InChI=1S/C19H22FN3OS2/c1-4-15(25)17(12-6-5-11(20)9-14(12)24-3)18(21-2)19-23-13-7-8-22-10-16(13)26-19/h5-6,9,21-22H,4,7-8,10H2,1-3H3 |
| InChIKey | QCASBZXVECFWFX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|