C13H19ClF3N3O2Si — CID 174101463
6-chloro-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)-4,5-dihydropyrazolo[4,3-c]pyridin-4-ol (PubChem CID 174101463) has the molecular formula C13H19ClF3N3O2Si and a molecular weight of 369.85 g/mol. Its IUPAC name is 6-chloro-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)-4,5-dihydropyrazolo[4,3-c]pyridin-4-ol.
| Compound Name | 6-chloro-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)-4,5-dihydropyrazolo[4,3-c]pyridin-4-ol |
|---|---|
| PubChem CID | 174101463 |
| Molecular Formula | C13H19ClF3N3O2Si |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 6-chloro-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)-4,5-dihydropyrazolo[4,3-c]pyridin-4-ol |
| SMILES | C[Si](C)(C)CCOCn1nc(C(F)(F)F)c2c1C=C(Cl)NC2O |
| InChI | InChI=1S/C13H19ClF3N3O2Si/c1-23(2,3)5-4-22-7-20-8-6-9(14)18-12(21)10(8)11(19-20)13(15,16)17/h6,12,18,21H,4-5,7H2,1-3H3 |
| InChIKey | MIQZYSNNOSQNKW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|