About CID 174101964
CID 174101964 (PubChem CID 174101964) has the molecular formula C45H23B4N3O10S
and a molecular weight of 841.01 g/mol.
Molecular Properties
| Compound Name | CID 174101964 |
| PubChem CID | 174101964 |
| Molecular Formula | C45H23B4N3O10S |
| Molecular Weight | 841.01 g/mol |
| Exact Mass | 841.15 |
| IUPAC Name | — |
| SMILES | [B]c1c(O)c([B])c2ooc3c(O)c(O)c(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccccc6)cc5)n4)c(O)c3c3cc(O)c(O)c4c3sc3c(c(O)c(O)c([B])c34)c2c1[B] |
| InChI | InChI=1S/C45H23B4N3O10S/c46-28-23-25-34(56)37(59)29(47)24-26-32(54)21(53)15-20(41(26)63-42(24)25)22-33(55)27(35(57)38(60)40(22)62-61-39(23)31(49)36(58)30(28)48)45-51-43(18-9-5-2-6-10-18)50-44(52-45)19-13-11-17(12-14-19)16-7-3-1-4-8-16/h1-15,53-60H |
| InChIKey | NSLSPNGWGFHKQG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 226.79 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
4 violations
| Rule | Value |
| MW ≤ 500 | 841.01 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze CID 174101964 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174101964?
The IUPAC name of CID 174101964 (CID 174101964) is not available.
What is the SMILES notation for CID 174101964?
The canonical SMILES for CID 174101964 is [B]c1c(O)c([B])c2ooc3c(O)c(O)c(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccccc6)cc5)n4)c(O)c3c3cc(O)c(O)c4c3sc3c(c(O)c(O)c([B])c34)c2c1[B].
What is the InChIKey of CID 174101964?
The InChIKey is NSLSPNGWGFHKQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H23B4N3O10S/c46-28-23-25-34(56)37(59)29(47)24-26-32(54)21(53)15-20(41(26)63-42(24)25)22-33(55)27(35(57)38(60)40(22)62-61-39(23)31(49)36(58)30(28)48)45-51-43(18-9-5-2-6-10-18)50-44(52-45)19-13-11-17(12-14-19)16-7-3-1-4-8-16/h1-15,53-60H.
What are the key properties of CID 174101964?
CID 174101964 has a molecular weight of 841.01 g/mol, XLogP of 5.50, 4 rotatable bonds, 8 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174101964 is sourced from PubChem (CID 174101964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).