C14H21BFNO — CID 174102193
[3-fluoro-5-(4,4,5,5-tetramethyloxaborolan-2-yl)phenyl]methanamine (PubChem CID 174102193) has the molecular formula C14H21BFNO and a molecular weight of 249.14 g/mol. Its IUPAC name is [3-fluoro-5-(4,4,5,5-tetramethyloxaborolan-2-yl)phenyl]methanamine.
| Compound Name | [3-fluoro-5-(4,4,5,5-tetramethyloxaborolan-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 174102193 |
| Molecular Formula | C14H21BFNO |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | [3-fluoro-5-(4,4,5,5-tetramethyloxaborolan-2-yl)phenyl]methanamine |
| SMILES | CC1(C)CB(c2cc(F)cc(CN)c2)OC1(C)C |
| InChI | InChI=1S/C14H21BFNO/c1-13(2)9-15(18-14(13,3)4)11-5-10(8-17)6-12(16)7-11/h5-7H,8-9,17H2,1-4H3 |
| InChIKey | XCQRVAKVUJMHMD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|