C25H38FN3O3Si — CID 174102514
[[1-tert-butyl-3-[(1S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorocyclopentyl]pyrazol-5-yl]amino] benzoate (PubChem CID 174102514) has the molecular formula C25H38FN3O3Si and a molecular weight of 475.68 g/mol. Its IUPAC name is [[1-tert-butyl-3-[(1S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorocyclopentyl]pyrazol-5-yl]amino] benzoate.
| Compound Name | [[1-tert-butyl-3-[(1S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorocyclopentyl]pyrazol-5-yl]amino] benzoate |
|---|---|
| PubChem CID | 174102514 |
| Molecular Formula | C25H38FN3O3Si |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | [[1-tert-butyl-3-[(1S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorocyclopentyl]pyrazol-5-yl]amino] benzoate |
| SMILES | CC(C)(C)n1nc([C@H]2CC(O[Si](C)(C)C(C)(C)C)[C@@H](F)C2)cc1NOC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H38FN3O3Si/c1-24(2,3)29-22(28-31-23(30)17-12-10-9-11-13-17)16-20(27-29)18-14-19(26)21(15-18)32-33(7,8)25(4,5)6/h9-13,16,18-19,21,28H,14-15H2,1-8H3/t18-,19+,21?/m1/s1 |
| InChIKey | SNMAKDKBJWXPNH-QSJYAPKHSA-N |
| XLogP | 6.43 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|