C14H27N — CID 174102743
(Z)-N-[(2S)-but-3-en-2-yl]-2,7-dimethyloct-5-en-1-amine (PubChem CID 174102743) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is (Z)-N-[(2S)-but-3-en-2-yl]-2,7-dimethyloct-5-en-1-amine.
| Compound Name | (Z)-N-[(2S)-but-3-en-2-yl]-2,7-dimethyloct-5-en-1-amine |
|---|---|
| PubChem CID | 174102743 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | (Z)-N-[(2S)-but-3-en-2-yl]-2,7-dimethyloct-5-en-1-amine |
| SMILES | C=C[C@H](C)NCC(C)CC/C=C\C(C)C |
| InChI | InChI=1S/C14H27N/c1-6-14(5)15-11-13(4)10-8-7-9-12(2)3/h6-7,9,12-15H,1,8,10-11H2,2-5H3/b9-7-/t13?,14-/m0/s1 |
| InChIKey | OODOBFOPCQUXJL-DPGPRNPXSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|