C42H39N3O3 — CID 174102956
N'-[[1-(4-phenylphenyl)ethylamino]-(3,4,5-trihydroxy-2,6-dimethylphenyl)methyl]-7,8-dihydrochrysene-3-carboximidamide (PubChem CID 174102956) has the molecular formula C42H39N3O3 and a molecular weight of 633.79 g/mol. Its IUPAC name is N'-[[1-(4-phenylphenyl)ethylamino]-(3,4,5-trihydroxy-2,6-dimethylphenyl)methyl]-7,8-dihydrochrysene-3-carboximidamide.
| Compound Name | N'-[[1-(4-phenylphenyl)ethylamino]-(3,4,5-trihydroxy-2,6-dimethylphenyl)methyl]-7,8-dihydrochrysene-3-carboximidamide |
|---|---|
| PubChem CID | 174102956 |
| Molecular Formula | C42H39N3O3 |
| Molecular Weight | 633.79 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | N'-[[1-(4-phenylphenyl)ethylamino]-(3,4,5-trihydroxy-2,6-dimethylphenyl)methyl]-7,8-dihydrochrysene-3-carboximidamide |
| SMILES | Cc1c(O)c(O)c(O)c(C)c1C(N=C(N)c1ccc2ccc3c4c(ccc3c2c1)CCC=C4)NC(C)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C42H39N3O3/c1-24-37(25(2)39(47)40(48)38(24)46)42(44-26(3)27-13-15-29(16-14-27)28-9-5-4-6-10-28)45-41(43)32-18-17-31-20-21-34-33-12-8-7-11-30(33)19-22-35(34)36(31)23-32/h4-6,8-10,12-23,26,42,44,46-48H,7,11H2,1-3H3,(H2,43,45) |
| InChIKey | JSLIDKAQYZTQNS-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.79 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|