C22H23F4N9O2 — CID 174103001
N-[[4-[4-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-1,3,5-triazin-2-yl]-3-fluoro-2-(trifluoromethyl)phenyl]methyl]-5-tert-butyl-1,2,4-oxadiazole-3-carboxamide (PubChem CID 174103001) has the molecular formula C22H23F4N9O2 and a molecular weight of 521.48 g/mol. Its IUPAC name is N-[[4-[4-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-1,3,5-triazin-2-yl]-3-fluoro-2-(trifluoromethyl)phenyl]methyl]-5-tert-butyl-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | N-[[4-[4-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-1,3,5-triazin-2-yl]-3-fluoro-2-(trifluoromethyl)phenyl]methyl]-5-tert-butyl-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 174103001 |
| Molecular Formula | C22H23F4N9O2 |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | N-[[4-[4-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-1,3,5-triazin-2-yl]-3-fluoro-2-(trifluoromethyl)phenyl]methyl]-5-tert-butyl-1,2,4-oxadiazole-3-carboxamide |
| SMILES | CN/C=C\C(N)=Nc1ncnc(-c2ccc(CNC(=O)c3noc(C(C)(C)C)n3)c(C(F)(F)F)c2F)n1 |
| InChI | InChI=1S/C22H23F4N9O2/c1-21(2,3)19-33-17(35-37-19)18(36)29-9-11-5-6-12(15(23)14(11)22(24,25)26)16-30-10-31-20(34-16)32-13(27)7-8-28-4/h5-8,10,28H,9H2,1-4H3,(H,29,36)(H2,27,30,31,32,34)/b8-7- |
| InChIKey | YRBNGECQNXMQGL-FPLPWBNLSA-N |
| XLogP | 3.03 |
| TPSA | 157.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|