About (6S)-4-[2,3-difluoro-4-(4-propan-2-ylphenyl)phenyl]-6-methylcyclohexa-2,4-dien-1-ol
(6S)-4-[2,3-difluoro-4-(4-propan-2-ylphenyl)phenyl]-6-methylcyclohexa-2,4-dien-1-ol (PubChem CID 174103012) has the molecular formula C22H22F2O
and a molecular weight of 340.41 g/mol. Its IUPAC name is (6S)-4-[2,3-difluoro-4-(4-propan-2-ylphenyl)phenyl]-6-methylcyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | (6S)-4-[2,3-difluoro-4-(4-propan-2-ylphenyl)phenyl]-6-methylcyclohexa-2,4-dien-1-ol |
| PubChem CID | 174103012 |
| Molecular Formula | C22H22F2O |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (6S)-4-[2,3-difluoro-4-(4-propan-2-ylphenyl)phenyl]-6-methylcyclohexa-2,4-dien-1-ol |
| SMILES | CC(C)c1ccc(-c2ccc(C3=C[C@H](C)C(O)C=C3)c(F)c2F)cc1 |
| InChI | InChI=1S/C22H22F2O/c1-13(2)15-4-6-16(7-5-15)18-9-10-19(22(24)21(18)23)17-8-11-20(25)14(3)12-17/h4-14,20,25H,1-3H3/t14-,20?/m0/s1 |
| InChIKey | GCQVQHKASWNBMC-PVCZSOGJSA-N |
| XLogP | 5.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6S)-4-[2,3-difluoro-4-(4-propan-2-ylphenyl)phenyl]-6-methylcyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-4-[2,3-difluoro-4-(4-propan-2-ylphenyl)phenyl]-6-methylcyclohexa-2,4-dien-1-ol?
The IUPAC name of (6S)-4-[2,3-difluoro-4-(4-propan-2-ylphenyl)phenyl]-6-methylcyclohexa-2,4-dien-1-ol (CID 174103012) is (6S)-4-[2,3-difluoro-4-(4-propan-2-ylphenyl)phenyl]-6-methylcyclohexa-2,4-dien-1-ol.
What is the SMILES notation for (6S)-4-[2,3-difluoro-4-(4-propan-2-ylphenyl)phenyl]-6-methylcyclohexa-2,4-dien-1-ol?
The canonical SMILES for (6S)-4-[2,3-difluoro-4-(4-propan-2-ylphenyl)phenyl]-6-methylcyclohexa-2,4-dien-1-ol is CC(C)c1ccc(-c2ccc(C3=C[C@H](C)C(O)C=C3)c(F)c2F)cc1.
What is the InChIKey of (6S)-4-[2,3-difluoro-4-(4-propan-2-ylphenyl)phenyl]-6-methylcyclohexa-2,4-dien-1-ol?
The InChIKey is GCQVQHKASWNBMC-PVCZSOGJSA-N. The full InChI is InChI=1S/C22H22F2O/c1-13(2)15-4-6-16(7-5-15)18-9-10-19(22(24)21(18)23)17-8-11-20(25)14(3)12-17/h4-14,20,25H,1-3H3/t14-,20?/m0/s1.
What are the key properties of (6S)-4-[2,3-difluoro-4-(4-propan-2-ylphenyl)phenyl]-6-methylcyclohexa-2,4-dien-1-ol?
(6S)-4-[2,3-difluoro-4-(4-propan-2-ylphenyl)phenyl]-6-methylcyclohexa-2,4-dien-1-ol has a molecular weight of 340.41 g/mol, XLogP of 5.71, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-4-[2,3-difluoro-4-(4-propan-2-ylphenyl)phenyl]-6-methylcyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 174103012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).