C28H35F2N9O2 — CID 174103335
N-[8-[4-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-1,3,5-triazin-2-yl]-2-(2,2-difluoropropyl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]-2-tert-butyl-1,3-oxazole-4-carboxamide (PubChem CID 174103335) has the molecular formula C28H35F2N9O2 and a molecular weight of 567.65 g/mol. Its IUPAC name is N-[8-[4-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-1,3,5-triazin-2-yl]-2-(2,2-difluoropropyl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]-2-tert-butyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[8-[4-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-1,3,5-triazin-2-yl]-2-(2,2-difluoropropyl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]-2-tert-butyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 174103335 |
| Molecular Formula | C28H35F2N9O2 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | N-[8-[4-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-1,3,5-triazin-2-yl]-2-(2,2-difluoropropyl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]-2-tert-butyl-1,3-oxazole-4-carboxamide |
| SMILES | CN/C=C\C(N)=Nc1ncnc(-c2ccc3c(c2)CN(CC(C)(F)F)CCC3NC(=O)c2coc(C(C)(C)C)n2)n1 |
| InChI | InChI=1S/C28H35F2N9O2/c1-27(2,3)25-36-21(14-41-25)24(40)35-20-9-11-39(15-28(4,29)30)13-18-12-17(6-7-19(18)20)23-33-16-34-26(38-23)37-22(31)8-10-32-5/h6-8,10,12,14,16,20,32H,9,11,13,15H2,1-5H3,(H,35,40)(H2,31,33,34,37,38)/b10-8- |
| InChIKey | GBCITDXDHICFHV-NTMALXAHSA-N |
| XLogP | 3.88 |
| TPSA | 147.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|