About 2,3-dimethyl-1,4-bis[3-(1-methylcyclopropyl)propyl]benzene
2,3-dimethyl-1,4-bis[3-(1-methylcyclopropyl)propyl]benzene (PubChem CID 174103745) has the molecular formula C22H34
and a molecular weight of 298.51 g/mol. Its IUPAC name is 2,3-dimethyl-1,4-bis[3-(1-methylcyclopropyl)propyl]benzene.
Molecular Properties
| Compound Name | 2,3-dimethyl-1,4-bis[3-(1-methylcyclopropyl)propyl]benzene |
| PubChem CID | 174103745 |
| Molecular Formula | C22H34 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 2,3-dimethyl-1,4-bis[3-(1-methylcyclopropyl)propyl]benzene |
| SMILES | Cc1c(CCCC2(C)CC2)ccc(CCCC2(C)CC2)c1C |
| InChI | InChI=1S/C22H34/c1-17-18(2)20(8-6-12-22(4)15-16-22)10-9-19(17)7-5-11-21(3)13-14-21/h9-10H,5-8,11-16H2,1-4H3 |
| InChIKey | KDULPVPPBQCARO-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-dimethyl-1,4-bis[3-(1-methylcyclopropyl)propyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1,4-bis[3-(1-methylcyclopropyl)propyl]benzene?
The IUPAC name of 2,3-dimethyl-1,4-bis[3-(1-methylcyclopropyl)propyl]benzene (CID 174103745) is 2,3-dimethyl-1,4-bis[3-(1-methylcyclopropyl)propyl]benzene.
What is the SMILES notation for 2,3-dimethyl-1,4-bis[3-(1-methylcyclopropyl)propyl]benzene?
The canonical SMILES for 2,3-dimethyl-1,4-bis[3-(1-methylcyclopropyl)propyl]benzene is Cc1c(CCCC2(C)CC2)ccc(CCCC2(C)CC2)c1C.
What is the InChIKey of 2,3-dimethyl-1,4-bis[3-(1-methylcyclopropyl)propyl]benzene?
The InChIKey is KDULPVPPBQCARO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34/c1-17-18(2)20(8-6-12-22(4)15-16-22)10-9-19(17)7-5-11-21(3)13-14-21/h9-10H,5-8,11-16H2,1-4H3.
What are the key properties of 2,3-dimethyl-1,4-bis[3-(1-methylcyclopropyl)propyl]benzene?
2,3-dimethyl-1,4-bis[3-(1-methylcyclopropyl)propyl]benzene has a molecular weight of 298.51 g/mol, XLogP of 6.55, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1,4-bis[3-(1-methylcyclopropyl)propyl]benzene is sourced from PubChem (CID 174103745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).