C14H23N2+ — CID 174103827
(6Z)-6-ethyl-3,4,8-trimethyl-5,8,9,10-tetrahydroimidazo[1,2-a]azocin-4-ium (PubChem CID 174103827) has the molecular formula C14H23N2+ and a molecular weight of 219.35 g/mol. Its IUPAC name is (6Z)-6-ethyl-3,4,8-trimethyl-5,8,9,10-tetrahydroimidazo[1,2-a]azocin-4-ium.
| Compound Name | (6Z)-6-ethyl-3,4,8-trimethyl-5,8,9,10-tetrahydroimidazo[1,2-a]azocin-4-ium |
|---|---|
| PubChem CID | 174103827 |
| Molecular Formula | C14H23N2+ |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.19 |
| IUPAC Name | (6Z)-6-ethyl-3,4,8-trimethyl-5,8,9,10-tetrahydroimidazo[1,2-a]azocin-4-ium |
| SMILES | CC/C1=C/C(C)CCC2=NC=C(C)[N+]2(C)C1 |
| InChI | InChI=1S/C14H23N2/c1-5-13-8-11(2)6-7-14-15-9-12(3)16(14,4)10-13/h8-9,11H,5-7,10H2,1-4H3/q+1/b13-8- |
| InChIKey | CLWOUCNCWSMTNI-JYRVWZFOSA-N |
| XLogP | 3.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|