C24H31N9O2 — CID 174104107
N-[3-[2-[(1-amino-1-methoxy-3-methyliminoprop-1-en-2-yl)amino]pyrimidin-4-yl]-1H-indol-7-yl]-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 174104107) has the molecular formula C24H31N9O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is N-[3-[2-[(1-amino-1-methoxy-3-methyliminoprop-1-en-2-yl)amino]pyrimidin-4-yl]-1H-indol-7-yl]-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N-[3-[2-[(1-amino-1-methoxy-3-methyliminoprop-1-en-2-yl)amino]pyrimidin-4-yl]-1H-indol-7-yl]-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 174104107 |
| Molecular Formula | C24H31N9O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | N-[3-[2-[(1-amino-1-methoxy-3-methyliminoprop-1-en-2-yl)amino]pyrimidin-4-yl]-1H-indol-7-yl]-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | C/N=C/C(Nc1nccc(-c2c[nH]c3c(NC(=O)CN4CCN(C)CC4)cccc23)n1)=C(N)OC |
| InChI | InChI=1S/C24H31N9O2/c1-26-14-20(23(25)35-3)31-24-27-8-7-18(30-24)17-13-28-22-16(17)5-4-6-19(22)29-21(34)15-33-11-9-32(2)10-12-33/h4-8,13-14,28H,9-12,15,25H2,1-3H3,(H,29,34)(H,27,30,31)/b23-20?,26-14+ |
| InChIKey | IGPHBNUEMPLHDG-FQEBERKFSA-N |
| XLogP | 1.70 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|