C12H23BO4S — CID 174104234
(3aS,6aR)-2-tert-butyl-3a,6a-diethyl-4,6-dihydrothieno[3,4-d][1,3,2]dioxaborole 5,5-dioxide (PubChem CID 174104234) has the molecular formula C12H23BO4S and a molecular weight of 274.19 g/mol. Its IUPAC name is (3aS,6aR)-2-tert-butyl-3a,6a-diethyl-4,6-dihydrothieno[3,4-d][1,3,2]dioxaborole 5,5-dioxide.
| Compound Name | (3aS,6aR)-2-tert-butyl-3a,6a-diethyl-4,6-dihydrothieno[3,4-d][1,3,2]dioxaborole 5,5-dioxide |
|---|---|
| PubChem CID | 174104234 |
| Molecular Formula | C12H23BO4S |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (3aS,6aR)-2-tert-butyl-3a,6a-diethyl-4,6-dihydrothieno[3,4-d][1,3,2]dioxaborole 5,5-dioxide |
| SMILES | CC[C@@]12CS(=O)(=O)C[C@]1(CC)OB(C(C)(C)C)O2 |
| InChI | InChI=1S/C12H23BO4S/c1-6-11-8-18(14,15)9-12(11,7-2)17-13(16-11)10(3,4)5/h6-9H2,1-5H3/t11-,12+ |
| InChIKey | IQAUWUIPNXVQDS-TXEJJXNPSA-N |
| XLogP | 2.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|