C12H20N2 — CID 174104334
(5R,8S)-3,3,5,8-tetramethyl-5,6,7,8-tetrahydropyrido[1,2-b]pyridazine (PubChem CID 174104334) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (5R,8S)-3,3,5,8-tetramethyl-5,6,7,8-tetrahydropyrido[1,2-b]pyridazine.
| Compound Name | (5R,8S)-3,3,5,8-tetramethyl-5,6,7,8-tetrahydropyrido[1,2-b]pyridazine |
|---|---|
| PubChem CID | 174104334 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (5R,8S)-3,3,5,8-tetramethyl-5,6,7,8-tetrahydropyrido[1,2-b]pyridazine |
| SMILES | C[C@@H]1CC[C@H](C)N2N=CC(C)(C)C=C12 |
| InChI | InChI=1S/C12H20N2/c1-9-5-6-10(2)14-11(9)7-12(3,4)8-13-14/h7-10H,5-6H2,1-4H3/t9-,10+/m1/s1 |
| InChIKey | YYCAIQIJCCIKFG-ZJUUUORDSA-N |
| XLogP | 3.02 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |