C23H20ClN5O3 — CID 174104439
N-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-2-[[2-(5-chloro-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyacetamide (PubChem CID 174104439) has the molecular formula C23H20ClN5O3 and a molecular weight of 449.90 g/mol. Its IUPAC name is N-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-2-[[2-(5-chloro-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyacetamide.
| Compound Name | N-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-2-[[2-(5-chloro-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyacetamide |
|---|---|
| PubChem CID | 174104439 |
| Molecular Formula | C23H20ClN5O3 |
| Molecular Weight | 449.90 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | N-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-2-[[2-(5-chloro-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyacetamide |
| SMILES | O=C(CON=C1C(c2c(O)[nH]c3ccc(Cl)cc23)=Nc2ccccc21)NC1[C@H]2CNC[C@@H]12 |
| InChI | InChI=1S/C23H20ClN5O3/c24-11-5-6-17-13(7-11)19(23(31)27-17)22-21(12-3-1-2-4-16(12)26-22)29-32-10-18(30)28-20-14-8-25-9-15(14)20/h1-7,14-15,20,25,27,31H,8-10H2,(H,28,30)/t14-,15+,20? |
| InChIKey | VKAISVBMXNXKGF-DBIVSCPCSA-N |
| XLogP | 2.72 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.90 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|