C54H45N5Si — CID 174105365
[3-[4-[3-(10-azatricyclo[4.3.1.03,8]decan-10-yl)carbazol-9-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-triphenylsilane (PubChem CID 174105365) has the molecular formula C54H45N5Si and a molecular weight of 792.08 g/mol. Its IUPAC name is [3-[4-[3-(10-azatricyclo[4.3.1.03,8]decan-10-yl)carbazol-9-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-triphenylsilane.
| Compound Name | [3-[4-[3-(10-azatricyclo[4.3.1.03,8]decan-10-yl)carbazol-9-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 174105365 |
| Molecular Formula | C54H45N5Si |
| Molecular Weight | 792.08 g/mol |
| Exact Mass | 791.34 |
| IUPAC Name | [3-[4-[3-(10-azatricyclo[4.3.1.03,8]decan-10-yl)carbazol-9-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-triphenylsilane |
| SMILES | c1ccc(-c2nc(-c3cccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)c3)nc(-n3c4ccccc4c4cc(N5C6CCC7CC5CC7C6)ccc43)n2)cc1 |
| InChI | InChI=1S/C54H45N5Si/c1-5-16-37(17-6-1)52-55-53(39-18-15-25-47(35-39)60(44-19-7-2-8-20-44,45-21-9-3-10-22-45)46-23-11-4-12-24-46)57-54(56-52)59-50-27-14-13-26-48(50)49-36-42(30-31-51(49)59)58-41-29-28-38-32-43(58)34-40(38)33-41/h1-27,30-31,35-36,38,40-41,43H,28-29,32-34H2 |
| InChIKey | SPVJUPCKUHSJMV-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.08 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|