C31H40BBrFN5O4Si — CID 174105518
[5-bromo-6-[[2-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]methyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 174105518) has the molecular formula C31H40BBrFN5O4Si and a molecular weight of 684.49 g/mol. Its IUPAC name is [5-bromo-6-[[2-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]methyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [5-bromo-6-[[2-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]methyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 174105518 |
| Molecular Formula | C31H40BBrFN5O4Si |
| Molecular Weight | 684.49 g/mol |
| Exact Mass | 683.21 |
| IUPAC Name | [5-bromo-6-[[2-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]methyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | Cc1ccnc(Oc2ccc(B3OC(C)(C)C(C)(Cc4c(Br)c5c(CO[Si](C)(C)C(C)(C)C)ncnc5n4C)O3)cc2F)n1 |
| InChI | InChI=1S/C31H40BBrFN5O4Si/c1-19-13-14-35-28(38-19)41-24-12-11-20(15-21(24)34)32-42-30(5,6)31(7,43-32)16-23-26(33)25-22(36-18-37-27(25)39(23)8)17-40-44(9,10)29(2,3)4/h11-15,18H,16-17H2,1-10H3 |
| InChIKey | SDVIBPYUECLCBS-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.49 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|