C22H40N2Si — CID 174105607
2-[ethenyl(phenyl)silyl]-1-N,1-N,1-N',1-N'-tetrapropylethane-1,1-diamine (PubChem CID 174105607) has the molecular formula C22H40N2Si and a molecular weight of 360.66 g/mol. Its IUPAC name is 2-[ethenyl(phenyl)silyl]-1-N,1-N,1-N',1-N'-tetrapropylethane-1,1-diamine.
| Compound Name | 2-[ethenyl(phenyl)silyl]-1-N,1-N,1-N',1-N'-tetrapropylethane-1,1-diamine |
|---|---|
| PubChem CID | 174105607 |
| Molecular Formula | C22H40N2Si |
| Molecular Weight | 360.66 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | 2-[ethenyl(phenyl)silyl]-1-N,1-N,1-N',1-N'-tetrapropylethane-1,1-diamine |
| SMILES | C=C[SiH](CC(N(CCC)CCC)N(CCC)CCC)c1ccccc1 |
| InChI | InChI=1S/C22H40N2Si/c1-6-16-23(17-7-2)22(24(18-8-3)19-9-4)20-25(10-5)21-14-12-11-13-15-21/h10-15,22,25H,5-9,16-20H2,1-4H3 |
| InChIKey | OGHFWQTUMKVMLL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.66 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|