C20H37FO3Si — CID 174105612
3-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-fluorobutanoic acid (PubChem CID 174105612) has the molecular formula C20H37FO3Si and a molecular weight of 372.60 g/mol. Its IUPAC name is 3-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-fluorobutanoic acid.
| Compound Name | 3-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-fluorobutanoic acid |
|---|---|
| PubChem CID | 174105612 |
| Molecular Formula | C20H37FO3Si |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 3-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-fluorobutanoic acid |
| SMILES | CC(C(F)C(=O)O)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C20H37FO3Si/c1-13(17(21)18(22)23)14-10-11-15-16(9-8-12-20(14,15)5)24-25(6,7)19(2,3)4/h13-17H,8-12H2,1-7H3,(H,22,23)/t13?,14-,15+,16+,17?,20-/m1/s1 |
| InChIKey | VGINYYWJPCELPD-FHKOXPHYSA-N |
| XLogP | 5.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|