C21H38F2O3Si — CID 174105633
4-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,2-difluoropentanoic acid (PubChem CID 174105633) has the molecular formula C21H38F2O3Si and a molecular weight of 404.61 g/mol. Its IUPAC name is 4-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,2-difluoropentanoic acid.
| Compound Name | 4-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,2-difluoropentanoic acid |
|---|---|
| PubChem CID | 174105633 |
| Molecular Formula | C21H38F2O3Si |
| Molecular Weight | 404.61 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 4-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,2-difluoropentanoic acid |
| SMILES | CC(CC(F)(F)C(=O)O)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C21H38F2O3Si/c1-14(13-21(22,23)18(24)25)15-10-11-16-17(9-8-12-20(15,16)5)26-27(6,7)19(2,3)4/h14-17H,8-13H2,1-7H3,(H,24,25)/t14?,15-,16+,17+,20-/m1/s1 |
| InChIKey | DZCSOPPOXYIABZ-CREGCZGOSA-N |
| XLogP | 6.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|