About azane;1H-pyrrol-2-ylcarbamodithioic acid
azane;1H-pyrrol-2-ylcarbamodithioic acid (PubChem CID 174105679) has the molecular formula C5H9N3S2
and a molecular weight of 175.28 g/mol. Its IUPAC name is azane;1H-pyrrol-2-ylcarbamodithioic acid.
Molecular Properties
| Compound Name | azane;1H-pyrrol-2-ylcarbamodithioic acid |
| PubChem CID | 174105679 |
| Molecular Formula | C5H9N3S2 |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | azane;1H-pyrrol-2-ylcarbamodithioic acid |
| SMILES | N.S=C(S)Nc1ccc[nH]1 |
| InChI | InChI=1S/C5H6N2S2.H3N/c8-5(9)7-4-2-1-3-6-4;/h1-3,6H,(H2,7,8,9);1H3 |
| InChIKey | PVTOFAYIZHDDDC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze azane;1H-pyrrol-2-ylcarbamodithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1H-pyrrol-2-ylcarbamodithioic acid?
The IUPAC name of azane;1H-pyrrol-2-ylcarbamodithioic acid (CID 174105679) is azane;1H-pyrrol-2-ylcarbamodithioic acid.
What is the SMILES notation for azane;1H-pyrrol-2-ylcarbamodithioic acid?
The canonical SMILES for azane;1H-pyrrol-2-ylcarbamodithioic acid is N.S=C(S)Nc1ccc[nH]1.
What is the InChIKey of azane;1H-pyrrol-2-ylcarbamodithioic acid?
The InChIKey is PVTOFAYIZHDDDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2S2.H3N/c8-5(9)7-4-2-1-3-6-4;/h1-3,6H,(H2,7,8,9);1H3.
What are the key properties of azane;1H-pyrrol-2-ylcarbamodithioic acid?
azane;1H-pyrrol-2-ylcarbamodithioic acid has a molecular weight of 175.28 g/mol, XLogP of 1.80, 1 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1H-pyrrol-2-ylcarbamodithioic acid is sourced from PubChem (CID 174105679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).