C24H44F2OSi — CID 174105696
[(1R,3aR,4S,7aR)-1-(4,4-difluoro-6-methylhept-6-en-2-yl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 174105696) has the molecular formula C24H44F2OSi and a molecular weight of 414.70 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-(4,4-difluoro-6-methylhept-6-en-2-yl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-1-(4,4-difluoro-6-methylhept-6-en-2-yl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 174105696 |
| Molecular Formula | C24H44F2OSi |
| Molecular Weight | 414.70 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-(4,4-difluoro-6-methylhept-6-en-2-yl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C(C)CC(F)(F)CC(C)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C24H44F2OSi/c1-17(2)15-24(25,26)16-18(3)19-12-13-20-21(11-10-14-23(19,20)7)27-28(8,9)22(4,5)6/h18-21H,1,10-16H2,2-9H3/t18?,19-,20+,21+,23-/m1/s1 |
| InChIKey | RZTUFEGYNHBXHZ-CYVPJEJKSA-N |
| XLogP | 8.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.70 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|