C18H39N3O9Si3 — CID 174105711
1,3,5-tris[2-[dimethoxy(methyl)silyl]ethyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 174105711) has the molecular formula C18H39N3O9Si3 and a molecular weight of 525.78 g/mol. Its IUPAC name is 1,3,5-tris[2-[dimethoxy(methyl)silyl]ethyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[2-[dimethoxy(methyl)silyl]ethyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 174105711 |
| Molecular Formula | C18H39N3O9Si3 |
| Molecular Weight | 525.78 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 1,3,5-tris[2-[dimethoxy(methyl)silyl]ethyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CO[Si](C)(CCn1c(=O)n(CC[Si](C)(OC)OC)c(=O)n(CC[Si](C)(OC)OC)c1=O)OC |
| InChI | InChI=1S/C18H39N3O9Si3/c1-25-31(7,26-2)13-10-19-16(22)20(11-14-32(8,27-3)28-4)18(24)21(17(19)23)12-15-33(9,29-5)30-6/h10-15H2,1-9H3 |
| InChIKey | OIXSEBRUNZSBHV-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 121.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.78 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|