C22H38F2O3Si — CID 174105740
(E,5S)-5-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4,4-difluorohex-2-enoic acid (PubChem CID 174105740) has the molecular formula C22H38F2O3Si and a molecular weight of 416.63 g/mol. Its IUPAC name is (E,5S)-5-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4,4-difluorohex-2-enoic acid.
| Compound Name | (E,5S)-5-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4,4-difluorohex-2-enoic acid |
|---|---|
| PubChem CID | 174105740 |
| Molecular Formula | C22H38F2O3Si |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (E,5S)-5-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4,4-difluorohex-2-enoic acid |
| SMILES | C[C@@H]([C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C)C(F)(F)/C=C/C(=O)O |
| InChI | InChI=1S/C22H38F2O3Si/c1-15(22(23,24)14-12-19(25)26)16-10-11-17-18(9-8-13-21(16,17)5)27-28(6,7)20(2,3)4/h12,14-18H,8-11,13H2,1-7H3,(H,25,26)/b14-12+/t15-,16+,17-,18-,21+/m0/s1 |
| InChIKey | PCPZXQVPTIBPKZ-BMIOINFVSA-N |
| XLogP | 6.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|