C24H42F2O2Si — CID 174105743
6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1-fluoro-2-(fluoromethyl)hept-3-yn-2-ol (PubChem CID 174105743) has the molecular formula C24H42F2O2Si and a molecular weight of 428.68 g/mol. Its IUPAC name is 6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1-fluoro-2-(fluoromethyl)hept-3-yn-2-ol.
| Compound Name | 6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1-fluoro-2-(fluoromethyl)hept-3-yn-2-ol |
|---|---|
| PubChem CID | 174105743 |
| Molecular Formula | C24H42F2O2Si |
| Molecular Weight | 428.68 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1-fluoro-2-(fluoromethyl)hept-3-yn-2-ol |
| SMILES | CC(CC#CC(O)(CF)CF)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C24H42F2O2Si/c1-18(10-8-15-24(27,16-25)17-26)19-12-13-20-21(11-9-14-23(19,20)5)28-29(6,7)22(2,3)4/h18-21,27H,9-14,16-17H2,1-7H3/t18?,19-,20+,21+,23-/m1/s1 |
| InChIKey | ZUKIUVNPIZSZOV-CYVPJEJKSA-N |
| XLogP | 6.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.68 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|