C22H39FO3Si — CID 174105745
(E,4S,5S)-5-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4-fluorohex-2-enoic acid (PubChem CID 174105745) has the molecular formula C22H39FO3Si and a molecular weight of 398.64 g/mol. Its IUPAC name is (E,4S,5S)-5-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4-fluorohex-2-enoic acid.
| Compound Name | (E,4S,5S)-5-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4-fluorohex-2-enoic acid |
|---|---|
| PubChem CID | 174105745 |
| Molecular Formula | C22H39FO3Si |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | (E,4S,5S)-5-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4-fluorohex-2-enoic acid |
| SMILES | C[C@@H]([C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C)[C@@H](F)/C=C/C(=O)O |
| InChI | InChI=1S/C22H39FO3Si/c1-15(18(23)12-13-20(24)25)16-10-11-17-19(9-8-14-22(16,17)5)26-27(6,7)21(2,3)4/h12-13,15-19H,8-11,14H2,1-7H3,(H,24,25)/b13-12+/t15-,16+,17-,18-,19-,22+/m0/s1 |
| InChIKey | AFZQLCMBEZDZFE-KZUOIUHFSA-N |
| XLogP | 6.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|