C28H51FO3Si — CID 174105748
ethyl (2E)-2-[(1R,3aS,7aR)-1-[(2R,5S)-5-fluoro-6-methyl-6-triethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]acetate (PubChem CID 174105748) has the molecular formula C28H51FO3Si and a molecular weight of 482.80 g/mol. Its IUPAC name is ethyl (2E)-2-[(1R,3aS,7aR)-1-[(2R,5S)-5-fluoro-6-methyl-6-triethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(1R,3aS,7aR)-1-[(2R,5S)-5-fluoro-6-methyl-6-triethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]acetate |
|---|---|
| PubChem CID | 174105748 |
| Molecular Formula | C28H51FO3Si |
| Molecular Weight | 482.80 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | ethyl (2E)-2-[(1R,3aS,7aR)-1-[(2R,5S)-5-fluoro-6-methyl-6-triethylsilyloxyheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CCC[C@]2(C)[C@@H]([C@H](C)CC[C@H](F)C(C)(C)O[Si](CC)(CC)CC)CC[C@@H]12 |
| InChI | InChI=1S/C28H51FO3Si/c1-9-31-26(30)20-22-14-13-19-28(8)23(16-17-24(22)28)21(5)15-18-25(29)27(6,7)32-33(10-2,11-3)12-4/h20-21,23-25H,9-19H2,1-8H3/b22-20+/t21-,23-,24+,25+,28-/m1/s1 |
| InChIKey | ZBELRVPIOAMJDW-AHBLYXDCSA-N |
| XLogP | 8.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.80 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|